Difference between revisions of "Digalactosylceramide-sulfate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...")
(Created page with "Category:metabolite == Metabolite Digalactosylceramide-sulfate == * common-name: ** a digalactosylceramide sulfate == Reaction(s) known to consume the compound == == React...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NARINGENIN-CMPD ==
+
== Metabolite Digalactosylceramide-sulfate ==
 
* common-name:
 
* common-name:
** (2s)-naringenin
+
** a digalactosylceramide sulfate
* smiles:
 
** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
 
* inchi-key:
 
** ftvwirxfelqlpi-zdusscgksa-n
 
* molecular-weight:
 
** 272.257
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[APIGNAR-RXN]]
+
* [[RXN-18303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-naringenin}}
+
{{#set: common-name=a digalactosylceramide sulfate}}
{{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}}
 
{{#set: molecular-weight=272.257}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Digalactosylceramide-sulfate

  • common-name:
    • a digalactosylceramide sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality