Difference between revisions of "1-CHLORO-24-DINITROBENZENE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TAGATOSE-6-PHOSPHATE == * common-name: ** d-tagatofuranose 6-phosphate * smiles: ** c(c1(oc(c(c1o)o)(o)co))op([o-])([o-])=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * smiles: ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) * in...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-CHLORO-24-DINITROBENZENE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-chloro-2,4-dinitrobenzene |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vyzahlcbvhpddf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 202.554 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GST-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GST-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-chloro-2,4-dinitrobenzene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=202.554}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 1-CHLORO-24-DINITROBENZENE
- common-name:
- 1-chloro-2,4-dinitrobenzene
- smiles:
- c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
- inchi-key:
- vyzahlcbvhpddf-uhfffaoysa-n
- molecular-weight:
- 202.554
