Difference between revisions of "BETA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-KETO-2-METHYLVALERATE == * common-name: ** (r)-2,3-dihydroxy-3-methylpentanoate * smiles: ** ccc(o)(c)c(c([o-])=o)o * inchi-key: ** pdg...") |
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) * inchi-key...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BETA-TOCOPHEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-tocopherol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wgvkwnupngfdfj-dqczwyhmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 416.686 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-2562]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-tocopherol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wgvkwnupngfdfj-dqczwyhmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=416.686}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite BETA-TOCOPHEROL
- common-name:
- β-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c))
- inchi-key:
- wgvkwnupngfdfj-dqczwyhmsa-n
- molecular-weight:
- 416.686
