Difference between revisions of "CPD-13122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite URACIL == * common-name: ** uracil * smiles: ** c1(=cc(nc(=o)n1)=o) * inchi-key: ** isakrjdgnuqoic-uhfffaoysa-n * molecular-weight: ** 11...")
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite URACIL ==
+
== Metabolite CPD-13122 ==
 
* common-name:
 
* common-name:
** uracil
+
** 4-deoxy-l-threo-hex-4-enopyranuronate
 
* smiles:
 
* smiles:
** c1(=cc(nc(=o)n1)=o)
+
** c(c1(oc(c(c(c=1)o)o)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** isakrjdgnuqoic-uhfffaoysa-n
+
** iakkjsvsfctlry-baktxgbysa-m
 
* molecular-weight:
 
* molecular-weight:
** 112.088
+
** 175.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5398]]
+
* [[RXN-16512]]
* [[URA-PHOSPH-RXN]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
* [[URPHOS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2584]]
+
* [[RXN-12177]]
* [[RXN0-5398]]
+
* [[RXN-12178]]
* [[URA-PHOSPH-RXN]]
+
* [[RXN-12270]]
* [[URIDINE-NUCLEOSIDASE-RXN]]
+
* [[RXN-16485]]
* [[URPHOS-RXN]]
+
* [[RXN-16512]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uracil}}
+
{{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}}
{{#set: inchi-key=inchikey=isakrjdgnuqoic-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}}
{{#set: molecular-weight=112.088}}
+
{{#set: molecular-weight=175.118}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13122

  • common-name:
    • 4-deoxy-l-threo-hex-4-enopyranuronate
  • smiles:
    • c(c1(oc(c(c(c=1)o)o)o))([o-])=o
  • inchi-key:
    • iakkjsvsfctlry-baktxgbysa-m
  • molecular-weight:
    • 175.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality