Difference between revisions of "Cerebrosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...")
(Created page with "Category:metabolite == Metabolite Cerebrosides == * common-name: ** a cerebroside == Reaction(s) known to consume the compound == * GALACTOSYLCERAMIDE-SULFOTRANSFERASE-R...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11408 ==
+
== Metabolite Cerebrosides ==
 
* common-name:
 
* common-name:
** triiodothyronine sulfate
+
** a cerebroside
* smiles:
 
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
 
* inchi-key:
 
** xbqyqxvjbndcgy-lbprgkrzsa-m
 
* molecular-weight:
 
** 730.028
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10615]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyronine sulfate}}
+
{{#set: common-name=a cerebroside}}
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
 
{{#set: molecular-weight=730.028}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Cerebrosides

  • common-name:
    • a cerebroside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality