Difference between revisions of "HISDEG-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+== Pathway HISDEG-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** cyanidin
+** l-histidine degradation i
-* smiles:
+== Reaction(s) found ==
-** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
+* [[HISTIDINE-AMMONIA-LYASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** vevzsmaejfvwil-uhfffaoysa-m
+* [NoneIMIDAZOLONEPROPIONASE-RXN IMIDAZOLONEPROPIONASE-RXN]
-* molecular-weight:
+* [NoneFORMIMINOGLUTAMASE-RXN FORMIMINOGLUTAMASE-RXN]
-** 285.232
+* [NoneUROCANATE-HYDRATASE-RXN UROCANATE-HYDRATASE-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-9725]]
+{{#set: common-name=l-histidine degradation i}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=cyanidin}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}}
-{{#set: molecular-weight=285.232}}