Difference between revisions of "LINAMARIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06670 == * transcription-direction: ** negative * right-end-position: ** 71128 * left-end-position: ** 54293 * centisome-position: ** 70.83235...") |
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite LINAMARIN == |
− | * | + | * common-name: |
− | ** | + | ** linamarin |
− | * | + | * smiles: |
− | ** | + | ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** qltchmyaejexbt-zebdfxrssa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 247.247 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-5341]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[RXN- | + | * [[RXN-13602]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=linamarin}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=qltchmyaejexbt-zebdfxrssa-n}} |
− | {{#set: | + | {{#set: molecular-weight=247.247}} |
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite LINAMARIN
- common-name:
- linamarin
- smiles:
- cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
- inchi-key:
- qltchmyaejexbt-zebdfxrssa-n
- molecular-weight:
- 247.247