Difference between revisions of "TYR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01401 == * transcription-direction: ** negative * right-end-position: ** 174558 * left-end-position: ** 159565 * centisome-position: ** 28.889904...")
 
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * smiles: ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * molecu...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01401 ==
+
== Metabolite TYR ==
* transcription-direction:
+
* common-name:
** negative
+
** l-tyrosine
* right-end-position:
+
* smiles:
** 174558
+
** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-]
* left-end-position:
+
* inchi-key:
** 159565
+
** ouycccasqsfeme-qmmmgpobsa-n
* centisome-position:
+
* molecular-weight:
** 28.889904   
+
** 181.191
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[6.3.2.25-RXN]]
== Reaction(s) associated ==
+
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
* [[3.6.4.5-RXN]]
+
* [[RXN-11319]]
** Category: [[annotation]]
+
* [[RXN-5861]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[TYROSINE--TRNA-LIGASE-RXN]]
* [[ATPASE-RXN]]
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
** Category: [[annotation]]
+
* [[TYROSINE-DECARBOXYLASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[biomass_rxn]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-5682]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
* [[RXN-12195]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=l-tyrosine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ouycccasqsfeme-qmmmgpobsa-n}}
* [[RXN-12196]]
+
{{#set: molecular-weight=181.191}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-5462]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7210]]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=174558}}
 
{{#set: left-end-position=159565}}
 
{{#set: centisome-position=28.889904    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=6}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite TYR

  • common-name:
    • l-tyrosine
  • smiles:
    • c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-]
  • inchi-key:
    • ouycccasqsfeme-qmmmgpobsa-n
  • molecular-weight:
    • 181.191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality