Difference between revisions of "CPD-11552"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15439 == * transcription-direction: ** positive * right-end-position: ** 23709 * left-end-position: ** 9256 * centisome-position: ** 3.1314492...") |
(Created page with "Category:metabolite == Metabolite CPD-11552 == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * smiles: ** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1) * in...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11552 == |
− | * | + | * common-name: |
− | ** | + | ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate |
− | + | * smiles: | |
− | + | ** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1) | |
− | + | * inchi-key: | |
− | * | + | ** ycjnyhccoxvyaf-uhfffaoysa-m |
− | + | * molecular-weight: | |
− | ** | + | ** 222.177 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10721]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10721]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}} | |
− | * | + | {{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}} |
− | + | {{#set: molecular-weight=222.177}} | |
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11552
- common-name:
- 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
- smiles:
- c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
- inchi-key:
- ycjnyhccoxvyaf-uhfffaoysa-m
- molecular-weight:
- 222.177