Difference between revisions of "CREATINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17585 == * transcription-direction: ** negative * right-end-position: ** 193956 * left-end-position: ** 181236 * centisome-position: ** 70.04047...")
 
(Created page with "Category:metabolite == Metabolite CREATINE == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi-key: ** cvsvtcorwbxhqv-uhfffaoysa-n * molecular-wei...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17585 ==
+
== Metabolite CREATINE ==
* transcription-direction:
+
* common-name:
** negative
+
** creatine
* right-end-position:
+
* smiles:
** 193956
+
** c(c(=o)[o-])n(c)c(n)=[n+]
* left-end-position:
+
* inchi-key:
** 181236
+
** cvsvtcorwbxhqv-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 70.04047   
+
** 131.134
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CREATINASE-RXN]]
== Reaction(s) associated ==
+
* [[CREATINE-KINASE-RXN]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[CREATININASE-RXN]]
* [[PEPDEPHOS-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[CREATINE-KINASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[CREATININASE-RXN]]
** Category: [[orthology]]
+
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-14117]]
+
{{#set: common-name=creatine}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=cvsvtcorwbxhqv-uhfffaoysa-n}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=131.134}}
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-14192]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-14207]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[P122-PWY]]
 
** '''16''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-5484]]
 
** '''10''' reactions found over '''11''' reactions in the full pathway
 
* [[P124-PWY]]
 
** '''12''' reactions found over '''15''' reactions in the full pathway
 
* [[PWY-1042]]
 
** '''9''' reactions found over '''10''' reactions in the full pathway
 
* [[P341-PWY]]
 
** '''6''' reactions found over '''10''' reactions in the full pathway
 
* [[GLYCOLYSIS]]
 
** '''11''' reactions found over '''12''' reactions in the full pathway
 
* [[ANAGLYCOLYSIS-PWY]]
 
** '''10''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY-7003]]
 
** '''8''' reactions found over '''6''' reactions in the full pathway
 
* [[FERMENTATION-PWY]]
 
** '''11''' reactions found over '''16''' reactions in the full pathway
 
* [[PWY-6886]]
 
** '''8''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-7218]]
 
** '''7''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-5723]]
 
** '''10''' reactions found over '''10''' reactions in the full pathway
 
* [[PWY-2221]]
 
** '''6''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-7383]]
 
** '''4''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-6901]]
 
** '''10''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6142]]
 
** '''10''' reactions found over '''13''' reactions in the full pathway
 
* [[NPGLUCAT-PWY]]
 
** '''4''' reactions found over '''9''' reactions in the full pathway
 
</div>
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=193956}}
 
{{#set: left-end-position=181236}}
 
{{#set: centisome-position=70.04047    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=17}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CREATINE

  • common-name:
    • creatine
  • smiles:
    • c(c(=o)[o-])n(c)c(n)=[n+]
  • inchi-key:
    • cvsvtcorwbxhqv-uhfffaoysa-n
  • molecular-weight:
    • 131.134

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality