Difference between revisions of "CREATINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17585 == * transcription-direction: ** negative * right-end-position: ** 193956 * left-end-position: ** 181236 * centisome-position: ** 70.04047...") |
(Created page with "Category:metabolite == Metabolite CREATINE == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi-key: ** cvsvtcorwbxhqv-uhfffaoysa-n * molecular-wei...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CREATINE == |
− | * | + | * common-name: |
− | ** | + | ** creatine |
− | * | + | * smiles: |
− | ** | + | ** c(c(=o)[o-])n(c)c(n)=[n+] |
− | + | * inchi-key: | |
− | + | ** cvsvtcorwbxhqv-uhfffaoysa-n | |
− | + | * molecular-weight: | |
− | + | ** 131.134 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[CREATINASE-RXN]] | |
− | + | * [[CREATINE-KINASE-RXN]] | |
− | + | * [[CREATININASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[CREATINE-KINASE-RXN]] | |
− | + | * [[CREATININASE-RXN]] | |
− | + | * [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=creatine}} | |
− | + | {{#set: inchi-key=inchikey=cvsvtcorwbxhqv-uhfffaoysa-n}} | |
− | ** | + | {{#set: molecular-weight=131.134}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CREATINE
- common-name:
- creatine
- smiles:
- c(c(=o)[o-])n(c)c(n)=[n+]
- inchi-key:
- cvsvtcorwbxhqv-uhfffaoysa-n
- molecular-weight:
- 131.134