Difference between revisions of "QUEUINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06446 == * transcription-direction: ** negative * right-end-position: ** 22392 * left-end-position: ** 12545 * centisome-position: ** 2.6382365...")
 
(Created page with "Category:metabolite == Metabolite QUEUINE == * common-name: ** queuine * smiles: ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) * inchi-key: ** wyrolenthwjflr-acldm...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06446 ==
+
== Metabolite QUEUINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** queuine
−
* right-end-position:
+
* smiles:
−
** 22392
+
** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
−
* left-end-position:
+
* inchi-key:
−
** 12545
+
** wyrolenthwjflr-acldmzeesa-o
−
* centisome-position:
+
* molecular-weight:
−
** 2.6382365   
+
** 278.29
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
+
{{#set: common-name=queuine}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=wyrolenthwjflr-acldmzeesa-o}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=278.29}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[LTAA-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14146]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-9896]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[THREONINE-ALDOLASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[3-HYDROXYPHENYLACETATE-DEGRADATION-PWY]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6100]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5436]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[GLYSYN-THR-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=22392}}
 
−
{{#set: left-end-position=12545}}
 
−
{{#set: centisome-position=2.6382365    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite QUEUINE

  • common-name:
    • queuine
  • smiles:
    • c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
  • inchi-key:
    • wyrolenthwjflr-acldmzeesa-o
  • molecular-weight:
    • 278.29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=QUEUINE&oldid=136713"