Difference between revisions of "CPD-12906"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21344 == * transcription-direction: ** negative * right-end-position: ** 191733 * left-end-position: ** 176698 * centisome-position: ** 90.96844...")
 
(Created page with "Category:metabolite == Metabolite CPD-12906 == * common-name: ** 5-methyl-3-oxo-4-hexenoyl-coa * smiles: ** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(oc...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21344 ==
+
== Metabolite CPD-12906 ==
* transcription-direction:
+
* common-name:
** negative
+
** 5-methyl-3-oxo-4-hexenoyl-coa
* right-end-position:
+
* smiles:
** 191733
+
** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 176698
+
** zfkzvsujtdsjey-svhodsnwsa-j
* centisome-position:
+
* molecular-weight:
** 90.96844   
+
** 887.641
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-11921]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DISULFOXRED-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=5-methyl-3-oxo-4-hexenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=zfkzvsujtdsjey-svhodsnwsa-j}}
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
+
{{#set: molecular-weight=887.641}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[THIOREDOX-PWY]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=191733}}
 
{{#set: left-end-position=176698}}
 
{{#set: centisome-position=90.96844    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-12906

  • common-name:
    • 5-methyl-3-oxo-4-hexenoyl-coa
  • smiles:
    • cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zfkzvsujtdsjey-svhodsnwsa-j
  • molecular-weight:
    • 887.641

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality