Difference between revisions of "PWY-7943"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] ==
+== Pathway PWY-7943 ==
+* taxonomic-range:
+** tax-38879
 * common-name:
-** l-histidinol phosphate
+** lycopadiene biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
+* [[2.5.1.32-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** cwnderhthmwbsi-yfkpbyrvsa-m
+* [NoneRXN-19157 RXN-19157]
-* molecular-weight:
+* [NoneRXN-19163 RXN-19163]
-** 220.144
+* [NoneRXN-19161 RXN-19161]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-19164 RXN-19164]
-* [[HISTAMINOTRANS-RXN]]
+* [NoneRXN-19159 RXN-19159]
-* [[HISTIDPHOS-RXN]]
+* [NoneRXN-19162 RXN-19162]
-* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
+{{#set: taxonomic-range=tax-38879}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=lycopadiene biosynthesis}}
-* [[HISTAMINOTRANS-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.14}}
-{{#set: common-name=l-histidinol phosphate}}
+{{#set: nb total reaction=7}}
-{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
-{{#set: molecular-weight=220.144}}