Difference between revisions of "L-1-GLYCEROPHOSPHORYLETHANOL-AMINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15712 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.6.4.4-RXN ** Categor...") |
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * smiles: ** c(op([o-])(occ(co)o)=o)c[n+] * inch...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == |
− | == | + | * common-name: |
− | * [[ | + | ** sn-glycero-3-phosphoethanolamine |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(op([o-])(occ(co)o)=o)c[n+] |
− | + | * inchi-key: | |
− | + | ** jznwscpgtdbmew-rxmqykedsa-n | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 215.142 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14160]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15035]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=sn-glycero-3-phosphoethanolamine}} | ||
+ | {{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}} | ||
+ | {{#set: molecular-weight=215.142}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- common-name:
- sn-glycero-3-phosphoethanolamine
- smiles:
- c(op([o-])(occ(co)o)=o)c[n+]
- inchi-key:
- jznwscpgtdbmew-rxmqykedsa-n
- molecular-weight:
- 215.142