Difference between revisions of "CPD-8089"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05313 == * transcription-direction: ** positive * right-end-position: ** 36811 * left-end-position: ** 25668 * centisome-position: ** 27.256798...") |
(Created page with "Category:metabolite == Metabolite CPD-8089 == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8089 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine |
| − | * | + | * smiles: |
| − | ** | + | ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** lpdgucimnbnwej-bxzvqshesa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 782.092 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8330]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-8321]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=1-α-linolenoyl-2-oleoyl-phosphatidylcholine}} | |
| − | == | + | {{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}} |
| − | + | {{#set: molecular-weight=782.092}} | |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-8089
- common-name:
- 1-α-linolenoyl-2-oleoyl-phosphatidylcholine
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- lpdgucimnbnwej-bxzvqshesa-n
- molecular-weight:
- 782.092
