Difference between revisions of "2-OCTAPRENYL-6-METHOXYPHENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17014 == * transcription-direction: ** positive * right-end-position: ** 109001 * left-end-position: ** 102092 * centisome-position: ** 37.352417...")
 
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL == * common-name: ** 2-methoxy-6-(all-trans-octaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17014 ==
+
== Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 2-methoxy-6-(all-trans-octaprenyl)phenol
−
* right-end-position:
+
* smiles:
−
** 109001
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 102092
+
** margkpimnmaskj-cmaxttdksa-n
−
* centisome-position:
+
* molecular-weight:
−
** 37.352417   
+
** 669.085
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
−
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=margkpimnmaskj-cmaxttdksa-n}}
−
* [[RXN-13564]]
+
{{#set: molecular-weight=669.085}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13565]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-4983]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6845]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=109001}}
 
−
{{#set: left-end-position=102092}}
 
−
{{#set: centisome-position=37.352417    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL

  • common-name:
    • 2-methoxy-6-(all-trans-octaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • margkpimnmaskj-cmaxttdksa-n
  • molecular-weight:
    • 669.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-OCTAPRENYL-6-METHOXYPHENOL&oldid=136956"