Difference between revisions of "CPD-7206"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02315 == * transcription-direction: ** positive * right-end-position: ** 134907 * left-end-position: ** 133726 * centisome-position: ** 96.672424...") |
(Created page with "Category:metabolite == Metabolite CPD-7206 == * common-name: ** 8'-apo-β-carotenal * smiles: ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c * inchi-key:...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7206 == |
| − | * | + | * common-name: |
| − | ** | + | ** 8'-apo-β-carotenal |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** dfmmvlfmmaqxhz-dokbywhisa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 416.645 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11783]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=8'-apo-β-carotenal}} | |
| − | + | {{#set: inchi-key=inchikey=dfmmvlfmmaqxhz-dokbywhisa-n}} | |
| − | + | {{#set: molecular-weight=416.645}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7206
- common-name:
- 8'-apo-β-carotenal
- smiles:
- cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c
- inchi-key:
- dfmmvlfmmaqxhz-dokbywhisa-n
- molecular-weight:
- 416.645
