Difference between revisions of "PWY-6019"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=...")
 
(Created page with "Category:pathway == Pathway PWY-6019 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** pseudouridine degradation == Reaction(s) found == * PSEUDOURIDINE-KINAS...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Pathway PWY-6019 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** red chlorophyll catabolite
+
** pseudouridine degradation
* smiles:
+
== Reaction(s) found ==
** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
+
* [[PSEUDOURIDINE-KINASE-RXN]]
* inchi-key:
+
* [[RXN0-5398]]
** gvtpycxgtfqzdt-yssugppcsa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 624.692
+
{{#set: taxonomic-range=tax-2|tax-2759}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=pseudouridine degradation}}
* [[RXN-7741]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
* [[RXN-7740]]
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=red chlorophyll catabolite}}
 
{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
 
{{#set: molecular-weight=624.692}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6019

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • pseudouridine degradation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present