Difference between revisions of "LINOLENIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07072 == * transcription-direction: ** negative * right-end-position: ** 318235 * left-end-position: ** 304028 * centisome-position: ** 65.47474...") |
(Created page with "Category:metabolite == Metabolite LINOLENIC_ACID == * common-name: ** α-linolenate * smiles: ** ccc=ccc=ccc=ccccccccc(=o)[o-] * inchi-key: ** dtosiqbpprvqhs-pdbxooch...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite LINOLENIC_ACID == |
− | * | + | * common-name: |
− | ** | + | ** α-linolenate |
− | + | * smiles: | |
− | * | + | ** ccc=ccc=ccc=ccccccccc(=o)[o-] |
− | + | * inchi-key: | |
− | ** | + | ** dtosiqbpprvqhs-pdbxoochsa-m |
− | + | * molecular-weight: | |
− | + | ** 277.426 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[LINOLENOYL-RXN]] | |
− | + | * [[LNLNCACOAL]] | |
− | + | * [[RXN-1321]] | |
− | + | * [[RXN-8497]] | |
− | + | * [[llcoas]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-1501_METACYC18.5]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=α-linolenate}} |
− | + | {{#set: inchi-key=inchikey=dtosiqbpprvqhs-pdbxoochsa-m}} | |
− | + | {{#set: molecular-weight=277.426}} | |
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | * | ||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite LINOLENIC_ACID
- common-name:
- α-linolenate
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)[o-]
- inchi-key:
- dtosiqbpprvqhs-pdbxoochsa-m
- molecular-weight:
- 277.426