Difference between revisions of "PHOSPHORIBOSYL-FORMIMINO-AICAR-P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10107 == * transcription-direction: ** positive * right-end-position: ** 184570 * left-end-position: ** 161730 * centisome-position: ** 40.618225...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == * common-name: ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == |
− | + | * common-name: | |
− | + | ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide | |
− | + | * smiles: | |
− | + | ** c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3) | |
− | * | + | * inchi-key: |
− | ** | + | ** qoushgmtbiiahr-keohhstqsa-j |
− | + | * molecular-weight: | |
− | + | ** 573.303 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[PRIBFAICARPISOM-RXN]] | |
− | + | * [[PRICI]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[HISTCYCLOHYD-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}} | |
− | + | {{#set: inchi-key=inchikey=qoushgmtbiiahr-keohhstqsa-j}} | |
− | + | {{#set: molecular-weight=573.303}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P
- common-name:
- 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
- smiles:
- c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3)
- inchi-key:
- qoushgmtbiiahr-keohhstqsa-j
- molecular-weight:
- 573.303
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.