Difference between revisions of "CPD-15125"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13121 == * transcription-direction: ** negative * right-end-position: ** 204117 * left-end-position: ** 201567 * centisome-position: ** 58.31906...") |
(Created page with "Category:metabolite == Metabolite CPD-15125 == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-] * inchi-key: ** apnidhdqyiszae...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15125 == |
− | * | + | * common-name: |
− | ** | + | ** 2,4-dihydroxyhept-2-enedioate |
− | * | + | * smiles: |
− | ** | + | ** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** apnidhdqyiszae-hyxafxhysa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 188.137 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14146]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-14146]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=2,4-dihydroxyhept-2-enedioate}} | |
− | + | {{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}} | |
− | + | {{#set: molecular-weight=188.137}} | |
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-15125
- common-name:
- 2,4-dihydroxyhept-2-enedioate
- smiles:
- c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
- inchi-key:
- apnidhdqyiszae-hyxafxhysa-l
- molecular-weight:
- 188.137