Difference between revisions of "PELARGONIDIN-3-GLUCOSIDE-CMPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12574 == * transcription-direction: ** positive * right-end-position: ** 114440 * left-end-position: ** 102698 * centisome-position: ** 28.711775...")
 
(Created page with "Category:metabolite == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == * common-name: ** pelargonidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12574 ==
+
== Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** pelargonidin-3-o-β-d-glucoside
−
* right-end-position:
+
* smiles:
−
** 114440
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
−
* left-end-position:
+
* inchi-key:
−
** 102698
+
** abvcubuixwjyse-gqupqbgvsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 28.711775   
+
** 431.375
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-7828]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
+
{{#set: common-name=pelargonidin-3-o-&beta;-d-glucoside}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=431.375}}
−
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RETINOL-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-10717]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10841]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12484]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12581]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14023]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[RIBITOLUTIL-PWY]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6307]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6861]]
 
−
** '''1''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-6872]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7178]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=114440}}
 
−
{{#set: left-end-position=102698}}
 
−
{{#set: centisome-position=28.711775    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=9}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD

  • common-name:
    • pelargonidin-3-o-β-d-glucoside
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
  • inchi-key:
    • abvcubuixwjyse-gqupqbgvsa-m
  • molecular-weight:
    • 431.375

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PELARGONIDIN-3-GLUCOSIDE-CMPD&oldid=137184"