Difference between revisions of "CPD-13174"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10802 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-7828 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-13174 == * common-name: ** salicyl-6-hydroxy-2-cyclohexene-on-oyl * smiles: ** c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o * inchi-ke...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13174 == |
| − | == | + | * common-name: |
| − | + | ** salicyl-6-hydroxy-2-cyclohexene-on-oyl | |
| − | + | * smiles: | |
| − | * | + | ** c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o |
| − | + | * inchi-key: | |
| − | ** | + | ** wyymyyoxcoemcu-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | + | ** 262.262 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | ** | + | * [[RXN-12252]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}} |
| − | + | {{#set: inchi-key=inchikey=wyymyyoxcoemcu-uhfffaoysa-n}} | |
| − | + | {{#set: molecular-weight=262.262}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13174
- common-name:
- salicyl-6-hydroxy-2-cyclohexene-on-oyl
- smiles:
- c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o
- inchi-key:
- wyymyyoxcoemcu-uhfffaoysa-n
- molecular-weight:
- 262.262
