Difference between revisions of "PORPHOBILINOGEN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03655 == * transcription-direction: ** positive * right-end-position: ** 136197 * left-end-position: ** 105471 * centisome-position: ** 10.334702...")
 
(Created page with "Category:metabolite == Metabolite PORPHOBILINOGEN == * common-name: ** porphobilinogen * smiles: ** c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+] * inchi-key: ** qshwiqzfgqk...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03655 ==
+
== Metabolite PORPHOBILINOGEN ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** porphobilinogen
−
* right-end-position:
+
* smiles:
−
** 136197
+
** c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+]
−
* left-end-position:
+
* inchi-key:
−
** 105471
+
** qshwiqzfgqkfma-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 10.334702   
+
** 225.224
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[OHMETHYLBILANESYN-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[PORPHOBILSYNTH-RXN]]
−
* [[PMPOXI-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=porphobilinogen}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=qshwiqzfgqkfma-uhfffaoysa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=225.224}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PNPOXI-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PYRIDOXINE-4-OXIDASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12752]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-13142]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PLPSAL-PWY]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7204]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PYRIDOXSYN-PWY]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7282]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5499]]
 
−
** '''1''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6938]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=136197}}
 
−
{{#set: left-end-position=105471}}
 
−
{{#set: centisome-position=10.334702    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite PORPHOBILINOGEN

  • common-name:
    • porphobilinogen
  • smiles:
    • c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+]
  • inchi-key:
    • qshwiqzfgqkfma-uhfffaoysa-m
  • molecular-weight:
    • 225.224

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PORPHOBILINOGEN&oldid=137294"