Difference between revisions of "5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10256 == * transcription-direction: ** positive * right-end-position: ** 28737 * left-end-position: ** 27346 * centisome-position: ** 86.57907...")
 
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == * common-name: ** prostaglandin f2α * smiles: ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10256 ==
+
== Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** prostaglandin f2α
−
* right-end-position:
+
* smiles:
−
** 28737
+
** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
−
* left-end-position:
+
* inchi-key:
−
** 27346
+
** pxgpltodnuvgfl-ynnpmvkqsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 86.57907   
+
** 353.478
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.1.1.188-RXN]]
−
== Reaction(s) associated ==
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
−
* [[2.4.1.134-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[1.1.1.188-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
−
* [[2.4.1.151-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=prostaglandin f2α}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=pxgpltodnuvgfl-ynnpmvkqsa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=353.478}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6557]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7434]]
 
−
** '''5''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=28737}}
 
−
{{#set: left-end-position=27346}}
 
−
{{#set: centisome-position=86.57907    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY

  • common-name:
    • prostaglandin f2α
  • smiles:
    • cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
  • inchi-key:
    • pxgpltodnuvgfl-ynnpmvkqsa-m
  • molecular-weight:
    • 353.478

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY&oldid=137296"