Difference between revisions of "P-NITROPHENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13034 == * transcription-direction: ** positive * right-end-position: ** 87930 * left-end-position: ** 82573 * centisome-position: ** 23.792482...")
 
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13034 ==
+
== Metabolite P-NITROPHENOL ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 4-nitrophenol
−
* right-end-position:
+
* smiles:
−
** 87930
+
** c1(c=c([o-])c=cc=1[n+](=o)[o-])
−
* left-end-position:
+
* inchi-key:
−
** 82573
+
** btjiuguipkrlhp-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 23.792482   
+
** 138.102
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
−
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
+
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-17830]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-8743]]
−
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
+
* [[RXN-8746]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=4-nitrophenol}}
−
* [[RXN-10717]]
+
{{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=138.102}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10841]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12484]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14023]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6307]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6861]]
 
−
** '''1''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7178]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=87930}}
 
−
{{#set: left-end-position=82573}}
 
−
{{#set: centisome-position=23.792482    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite P-NITROPHENOL

  • common-name:
    • 4-nitrophenol
  • smiles:
    • c1(c=c([o-])c=cc=1[n+](=o)[o-])
  • inchi-key:
    • btjiuguipkrlhp-uhfffaoysa-m
  • molecular-weight:
    • 138.102

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=P-NITROPHENOL&oldid=137337"