Difference between revisions of "SJ01397"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == * common-name: ** (5s)-hpete * smiles: ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o * inchi-key: ** jnuun...")
(Created page with "Category:gene == Gene SJ01397 == * transcription-direction: ** positive * right-end-position: ** 100362 * left-end-position: ** 74359 * centisome-position: ** 13.463004...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 ==
+
== Gene SJ01397 ==
* common-name:
+
* transcription-direction:
** (5s)-hpete
+
** positive
* smiles:
+
* right-end-position:
** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o
+
** 100362
* inchi-key:
+
* left-end-position:
** jnuunuqhxiofda-jgklhwiesa-m
+
** 74359
* molecular-weight:
+
* centisome-position:
** 335.462
+
** 13.463004   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8647]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(5s)-hpete}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=jnuunuqhxiofda-jgklhwiesa-m}}
+
== Pathway(s) associated ==
{{#set: molecular-weight=335.462}}
+
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=100362}}
 +
{{#set: left-end-position=74359}}
 +
{{#set: centisome-position=13.463004    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:10, 18 March 2021

Gene SJ01397

  • transcription-direction:
    • positive
  • right-end-position:
    • 100362
  • left-end-position:
    • 74359
  • centisome-position:
    • 13.463004

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway