Difference between revisions of "SJ01397"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == * common-name: ** (5s)-hpete * smiles: ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o * inchi-key: ** jnuun...") |
(Created page with "Category:gene == Gene SJ01397 == * transcription-direction: ** positive * right-end-position: ** 100362 * left-end-position: ** 74359 * centisome-position: ** 13.463004...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ01397 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 100362 |
− | * | + | * left-end-position: |
− | ** | + | ** 74359 |
− | * | + | * centisome-position: |
− | ** | + | ** 13.463004 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | == Reaction(s) | + | == Reaction(s) associated == |
− | * [[ | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | == | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | == Pathway(s) associated == |
− | {{#set: | + | * [[PWY-7511]] |
+ | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=positive}} | ||
+ | {{#set: right-end-position=100362}} | ||
+ | {{#set: left-end-position=74359}} | ||
+ | {{#set: centisome-position=13.463004 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} | ||
+ | {{#set: nb pathway associated=1}} |
Latest revision as of 11:10, 18 March 2021
Contents
Gene SJ01397
- transcription-direction:
- positive
- right-end-position:
- 100362
- left-end-position:
- 74359
- centisome-position:
- 13.463004
Organism(s) associated with this gene
Reaction(s) associated
- UBIQUITIN--PROTEIN-LIGASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-7511
- 7 reactions found over 9 reactions in the full pathway