Difference between revisions of "DNA-Combined-With-Exogenous-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6746 == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite DNA-Combined-With-Exogenous-DNA == * common-name: ** dna combined with exogenous dna to form a recombinational junction == Reaction(s) kn...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-Combined-With-Exogenous-DNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** dna combined with exogenous dna to form a recombinational junction |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.1.22.4-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dna combined with exogenous dna to form a recombinational junction}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DNA-Combined-With-Exogenous-DNA
- common-name:
- dna combined with exogenous dna to form a recombinational junction
