Difference between revisions of "GDP-TP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADP-D-Ribosyl-Acceptors == * common-name: ** an adp-d-ribosyl acceptor == Reaction(s) known to consume the compound == * NAD+-ADP-RIBOS...") |
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GDP-TP == |
* common-name: | * common-name: | ||
− | ** | + | ** pppgpp |
+ | * smiles: | ||
+ | ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** kcpmacxzaitqax-uuokfmhzsa-h | ||
+ | * molecular-weight: | ||
+ | ** 677.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-6427]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GTPPYPHOSKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pppgpp}} |
+ | {{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}} | ||
+ | {{#set: molecular-weight=677.095}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GDP-TP
- common-name:
- pppgpp
- smiles:
- c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- kcpmacxzaitqax-uuokfmhzsa-h
- molecular-weight:
- 677.095