Difference between revisions of "CPD-692"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12953 == * transcription-direction: ** positive * right-end-position: ** 25369 * left-end-position: ** 13172 * centisome-position: ** 3.7793882...")
 
(Created page with "Category:metabolite == Metabolite CPD-692 == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** rikwdzwvhuiuam-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12953 ==
+
== Metabolite CPD-692 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (+)-cis-abscisic aldehyde
−
* right-end-position:
+
* smiles:
−
** 25369
+
** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
−
* left-end-position:
+
* inchi-key:
−
** 13172
+
** rikwdzwvhuiuam-kicrzjjpsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 3.7793882   
+
** 248.321
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.2.3.14-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GLUTAMIDOTRANS-RXN]]
+
* [[1.1.1.288-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(+)-cis-abscisic aldehyde}}
−
* [[GLUTAMIN-RXN]]
+
{{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=248.321}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PRIBFAICARPISOM-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PRICI]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17900]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[HISTSYN-PWY]]
 
−
** '''10''' reactions found over '''10''' reactions in the full pathway
 
−
* [[CITRULBIO-PWY]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[GLUTAMINDEG-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=25369}}
 
−
{{#set: left-end-position=13172}}
 
−
{{#set: centisome-position=3.7793882    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-692

  • common-name:
    • (+)-cis-abscisic aldehyde
  • smiles:
    • cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
  • inchi-key:
    • rikwdzwvhuiuam-kicrzjjpsa-n
  • molecular-weight:
    • 248.321

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-692&oldid=137392"