Difference between revisions of "CPD-19759"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...")
(Created page with "Category:metabolite == Metabolite CPD-19759 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-490 ==
+
== Metabolite CPD-19759 ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** α-d-xylose 1-phosphate
+
** 71-dihydroxychlorophyllide a
* smiles:
 
** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
 
* inchi-key:
 
** ilxhfxfppzgenn-kkqcnmdgsa-l
 
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 644.965
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.11-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.11-RXN]]
+
* [[RXN-7677]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-xylose 1-phosphate}}
+
{{#set: common-name=71-dihydroxychlorophyllide a}}
{{#set: inchi-key=inchikey=ilxhfxfppzgenn-kkqcnmdgsa-l}}
+
{{#set: molecular-weight=644.965}}
{{#set: molecular-weight=228.095}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-19759

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c(o)o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 71-dihydroxychlorophyllide a
  • molecular-weight:
    • 644.965

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality