Difference between revisions of "CPD-67"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09951 == * transcription-direction: ** positive * right-end-position: ** 304964 * left-end-position: ** 303581 * centisome-position: ** 75.53852...") |
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-67 == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-phosphoglycolate |
| − | * | + | * smiles: |
| − | ** | + | ** c(op([o-])(=o)[o-])c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** ascfnmcahfubco-uhfffaoysa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 153.008 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[GPH-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=2-phosphoglycolate}} | |
| − | + | {{#set: inchi-key=inchikey=ascfnmcahfubco-uhfffaoysa-k}} | |
| − | {{#set: | + | {{#set: molecular-weight=153.008}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-67
- common-name:
- 2-phosphoglycolate
- smiles:
- c(op([o-])(=o)[o-])c([o-])=o
- inchi-key:
- ascfnmcahfubco-uhfffaoysa-k
- molecular-weight:
- 153.008
