Difference between revisions of "L-DEHYDRO-ASCORBATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10420 == * common-name: ** 4-sulfomuconolactone * smiles: ** c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1) * inchi-key: ** weeoykxhmipyqx...") |
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-DEHYDRO-ASCORBATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-dehydro-ascorbate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sbjkkffyizucet-szscbosdsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 174.11 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[1.8.5.1-RXN]] |
+ | * [[RXN-13185]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | ||
+ | * [[ETHYL-RXN]] | ||
+ | * [[RXN-12440]] | ||
+ | * [[RXN-13185]] | ||
+ | * [[RXN-19200]] | ||
+ | * [[RXN-7984]] | ||
+ | * [[RXN-7985]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-dehydro-ascorbate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.11}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-DEHYDRO-ASCORBATE
- common-name:
- l-dehydro-ascorbate
- smiles:
- c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
- inchi-key:
- sbjkkffyizucet-szscbosdsa-n
- molecular-weight:
- 174.11