Difference between revisions of "CPD-12706"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BUTYRIC_ACID == * common-name: ** butanoate * smiles: ** cccc(=o)[o-] * inchi-key: ** feriucnnqqjtoy-uhfffaoysa-m * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD-12706 == * common-name: ** 5-fluoro-5-deoxy-d-ribose 1-phosphate * smiles: ** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f * inchi-key: ** luq...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BUTYRIC_ACID ==
+
== Metabolite CPD-12706 ==
 
* common-name:
 
* common-name:
** butanoate
+
** 5-fluoro-5-deoxy-d-ribose 1-phosphate
 
* smiles:
 
* smiles:
** cccc(=o)[o-]
+
** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f
 
* inchi-key:
 
* inchi-key:
** feriucnnqqjtoy-uhfffaoysa-m
+
** luqfmenctwebsq-txicztdvsa-l
 
* molecular-weight:
 
* molecular-weight:
** 87.098
+
** 230.086
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12086]]
+
* [[RXN-11743]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=butanoate}}
+
{{#set: common-name=5-fluoro-5-deoxy-d-ribose 1-phosphate}}
{{#set: inchi-key=inchikey=feriucnnqqjtoy-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=luqfmenctwebsq-txicztdvsa-l}}
{{#set: molecular-weight=87.098}}
+
{{#set: molecular-weight=230.086}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-12706

  • common-name:
    • 5-fluoro-5-deoxy-d-ribose 1-phosphate
  • smiles:
    • c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f
  • inchi-key:
    • luqfmenctwebsq-txicztdvsa-l
  • molecular-weight:
    • 230.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality