Difference between revisions of "CIS-ACONITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11913 == * transcription-direction: ** positive * right-end-position: ** 389858 * left-end-position: ** 374707 * centisome-position: ** 48.454765...")
 
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11913 ==
+
== Metabolite CIS-ACONITATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** cis-aconitate
−
* right-end-position:
+
* smiles:
−
** 389858
+
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 374707
+
** gtzcvfvgugfeme-iwqzzhsrsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 48.454765   
+
** 171.086
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) associated ==
+
* [[ACONITATEHYDR-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[G6PADH]]
+
* [[ACONITATEDEHYDR-RXN]]
−
** Category: [[orthology]]
+
* [[ACONITATEHYDR-RXN]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[G6PADHh]]
+
{{#set: common-name=cis-aconitate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=171.086}}
−
* [[G6PBDH]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[G6PBDHh]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[GLU6PDEHYDROG-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14819]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7268]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[P122-PWY]]
 
−
** '''16''' reactions found over '''18''' reactions in the full pathway
 
−
* [[GLYCOLYSIS-E-D]]
 
−
** '''4''' reactions found over '''2''' reactions in the full pathway
 
−
* [[OXIDATIVEPENT-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[RUMP-PWY]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=389858}}
 
−
{{#set: left-end-position=374707}}
 
−
{{#set: centisome-position=48.454765    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CIS-ACONITATE

  • common-name:
    • cis-aconitate
  • smiles:
    • c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
  • inchi-key:
    • gtzcvfvgugfeme-iwqzzhsrsa-k
  • molecular-weight:
    • 171.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CIS-ACONITATE&oldid=137440"