Difference between revisions of "CPD-7953"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1...")
(Created page with "Category:metabolite == Metabolite CPD-7953 == * common-name: ** torulene * smiles: ** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c * inchi-key...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-KETO-ADIPYL-COA ==
+
== Metabolite CPD-7953 ==
 
* common-name:
 
* common-name:
** 3-oxoadipyl-coa
+
** torulene
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** vkkkaapgxhwxoo-biewrjsysa-i
+
** aibohnyykwyqmm-mxbsltgdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 904.605
+
** 534.867
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2044]]
+
* [[RXN-11989]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2044]]
+
* [[RXN-11976]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxoadipyl-coa}}
+
{{#set: common-name=torulene}}
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
+
{{#set: inchi-key=inchikey=aibohnyykwyqmm-mxbsltgdsa-n}}
{{#set: molecular-weight=904.605}}
+
{{#set: molecular-weight=534.867}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-7953

  • common-name:
    • torulene
  • smiles:
    • cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c
  • inchi-key:
    • aibohnyykwyqmm-mxbsltgdsa-n
  • molecular-weight:
    • 534.867

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality