Difference between revisions of "N6-Methyladenine-containing-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19162 == * common-name: ** (2e,9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
(Created page with "Category:metabolite == Metabolite N6-Methyladenine-containing-mRNAs == * common-name: ** an n6-methyladenine in mrna == Reaction(s) known to consume the compound == * RX...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19162 ==
+
== Metabolite N6-Methyladenine-containing-mRNAs ==
 
* common-name:
 
* common-name:
** (2e,9z)-hexadecenoyl-coa
+
** an n6-methyladenine in mrna
* smiles:
 
** ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** beqwcbbskhmrca-henmzmgosa-j
 
* molecular-weight:
 
** 997.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17789]]
+
* [[RXN-17811]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17788]]
+
* [[RXN-17811]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z)-hexadecenoyl-coa}}
+
{{#set: common-name=an n6-methyladenine in mrna}}
{{#set: inchi-key=inchikey=beqwcbbskhmrca-henmzmgosa-j}}
 
{{#set: molecular-weight=997.883}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite N6-Methyladenine-containing-mRNAs

  • common-name:
    • an n6-methyladenine in mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality