Difference between revisions of "PHENYLALANINE-DEG1-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)...")
 
(Created page with "Category:pathway == Pathway PHENYLALANINE-DEG1-PWY == * taxonomic-range: ** tax-4751 ** tax-40674 ** tax-2 * common-name: ** l-phenylalanine degradation i (aerobic) == Rea...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] ==
+
== Pathway PHENYLALANINE-DEG1-PWY ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-40674
 +
** tax-2
 
* common-name:
 
* common-name:
** l-tryptophan
+
** l-phenylalanine degradation i (aerobic)
* smiles:
+
== Reaction(s) found ==
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
+
* [[RXN-7908]]
* inchi-key:
+
== Reaction(s) not found ==
** qivbcdijiajpqs-vifpvbqesa-n
+
* [NoneRXN66-569 RXN66-569]
* molecular-weight:
+
{{#set: taxonomic-range=tax-4751|tax-40674|tax-2}}
** 204.228
+
{{#set: common-name=l-phenylalanine degradation i (aerobic)}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
+
{{#set: completion rate=1.0}}
* [[RXN-8665]]
+
{{#set: nb total reaction=1}}
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
 
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
* [[RXN0-2382]]
 
* [[TRYPSYN-RXN]]
 
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=l-tryptophan}}
 
{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
 
{{#set: molecular-weight=204.228}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PHENYLALANINE-DEG1-PWY

  • taxonomic-range:
    • tax-4751
    • tax-40674
    • tax-2
  • common-name:
    • l-phenylalanine degradation i (aerobic)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN66-569 RXN66-569]