Difference between revisions of "5-HYDROXYINDOLE ACETALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == * common-name: ** 5-hydroxyindole acetaldehyde * smiles: ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) * inchi-key:...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxyindole acetaldehyde |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** obfapciusyhfie-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 175.187 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10780]] |
| − | * [[RXN- | + | * [[RXN-10781]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-10778]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxyindole acetaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=obfapciusyhfie-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=175.187}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE
- common-name:
- 5-hydroxyindole acetaldehyde
- smiles:
- c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o))
- inchi-key:
- obfapciusyhfie-uhfffaoysa-n
- molecular-weight:
- 175.187
