Difference between revisions of "CPD-14159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-flavodoxins == * common-name: ** a reduced flavodoxin == Reaction(s) known to consume the compound == * FLAVONADPREDUCT-RXN *...")
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-flavodoxins ==
+
== Metabolite CPD-14159 ==
 
* common-name:
 
* common-name:
** a reduced flavodoxin
+
** 6''-o-carbamoylkanamycin b
 +
* smiles:
 +
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
 +
* inchi-key:
 +
** xcstznjiqfivpe-fqsmhnglsa-s
 +
* molecular-weight:
 +
** 531.582
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FLAVONADPREDUCT-RXN]]
 
* [[PYFLAVOXRE-RXN]]
 
* [[RXN-15878]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FLAVONADPREDUCT-RXN]]
+
* [[RXN-14553]]
* [[PYFLAVOXRE-RXN]]
+
* [[RXN-15287]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced flavodoxin}}
+
{{#set: common-name=6''-o-carbamoylkanamycin b}}
 +
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
 +
{{#set: molecular-weight=531.582}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14159

  • common-name:
    • 6-o-carbamoylkanamycin b
  • smiles:
    • c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • xcstznjiqfivpe-fqsmhnglsa-s
  • molecular-weight:
    • 531.582

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality