Difference between revisions of "5-METHYLTHIOADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MAP-Kinase-L-Tyr == * common-name: ** a [mitogen-activated protein kinase]-l-tyrosine == Reaction(s) known to consume the compound == * [...")
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MAP-Kinase-L-Tyr ==
+
== Metabolite 5-METHYLTHIOADENOSINE ==
 
* common-name:
 
* common-name:
** a [mitogen-activated protein kinase]-l-tyrosine
+
** s-methyl-5'-thioadenosine
 +
* smiles:
 +
** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
 +
* inchi-key:
 +
** wuugfsxjnotrmr-ioslpcccsa-n
 +
* molecular-weight:
 +
** 297.331
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16317]]
+
* [[M5TAP]]
 +
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
 +
* [[RXN-11190]]
 +
* [[SPERMIDINESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16317]]
+
* [[4.4.1.14-RXN]]
 +
* [[APAPT]]
 +
* [[RXN-11190]]
 +
* [[RXN-11371]]
 +
* [[RXN-14518]]
 +
* [[RXN0-5217]]
 +
* [[SPERMIDINESYN-RXN]]
 +
* [[SPERMINE-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [mitogen-activated protein kinase]-l-tyrosine}}
+
{{#set: common-name=s-methyl-5'-thioadenosine}}
 +
{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}
 +
{{#set: molecular-weight=297.331}}

Latest revision as of 11:14, 18 March 2021

Metabolite 5-METHYLTHIOADENOSINE

  • common-name:
    • s-methyl-5'-thioadenosine
  • smiles:
    • cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
  • inchi-key:
    • wuugfsxjnotrmr-ioslpcccsa-n
  • molecular-weight:
    • 297.331

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality