Difference between revisions of "C5"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-phospho-L-seryl-tRNASecs == * common-name: ** an o-phospho-l-seryl-[trnasec] == Reaction(s) known to consume the compound == * RXN-10...") |
(Created page with "Category:metabolite == Metabolite C5 == * common-name: ** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine *...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite C5 == |
* common-name: | * common-name: | ||
− | ** | + | ** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc([n+])c(=o)[o-])c(nc(c)c(=o)nc(c)c([o-])=o)=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** pnwzqtonlrrpst-kldrqjoasa-j | ||
+ | * molecular-weight: | ||
+ | ** 1713.036 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[PHOSNACMURPENTATRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}} |
+ | {{#set: inchi-key=inchikey=pnwzqtonlrrpst-kldrqjoasa-j}} | ||
+ | {{#set: molecular-weight=1713.036}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite C5
- common-name:
- undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc([n+])c(=o)[o-])c(nc(c)c(=o)nc(c)c([o-])=o)=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
- inchi-key:
- pnwzqtonlrrpst-kldrqjoasa-j
- molecular-weight:
- 1713.036