Difference between revisions of "SACCHAROPINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL == * common-name: ** acetophenone * smiles: ** cc(=o)c1(c=cc=cc=1) * inchi-key: ** kwolfjpfchcocg-uhfffaoysa-n * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite SACCHAROPINE == * common-name: ** l-saccharopine * smiles: ** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o * inchi-key: ** zdgjahtzv...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYL ==
+
== Metabolite SACCHAROPINE ==
 
* common-name:
 
* common-name:
** acetophenone
+
** l-saccharopine
 
* smiles:
 
* smiles:
** cc(=o)c1(c=cc=cc=1)
+
** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** kwolfjpfchcocg-uhfffaoysa-n
+
** zdgjahtzvhvlot-yumqzzprsa-m
 
* molecular-weight:
 
* molecular-weight:
** 120.151
+
** 275.281
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1302]]
+
* [[1.5.1.9-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1302]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acetophenone}}
+
{{#set: common-name=l-saccharopine}}
{{#set: inchi-key=inchikey=kwolfjpfchcocg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=zdgjahtzvhvlot-yumqzzprsa-m}}
{{#set: molecular-weight=120.151}}
+
{{#set: molecular-weight=275.281}}

Latest revision as of 11:14, 18 March 2021

Metabolite SACCHAROPINE

  • common-name:
    • l-saccharopine
  • smiles:
    • c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
  • inchi-key:
    • zdgjahtzvhvlot-yumqzzprsa-m
  • molecular-weight:
    • 275.281

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality