Difference between revisions of "AICAR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-LACTOYL-GLUTATHIONE == * common-name: ** (r)-s-lactoylglutathione * smiles: ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o...")
(Created page with "Category:metabolite == Metabolite AICAR == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-LACTOYL-GLUTATHIONE ==
+
== Metabolite AICAR ==
 
* common-name:
 
* common-name:
** (r)-s-lactoylglutathione
+
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
 
* smiles:
 
* smiles:
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
 
* inchi-key:
 
* inchi-key:
** vdydcvuwiliyqf-csmhccousa-m
+
** notgfiuvdgnkri-uuokfmhzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 378.376
+
** 336.197
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYOXI-RXN]]
+
* [[AIAL]]
* [[GLYOXII-RXN]]
+
* [[AICARSYN-RXN]]
 +
* [[AICARTRANSFORM-RXN]]
 +
* [[FPAIF]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYOXI-RXN]]
+
* [[AIAL]]
 +
* [[AICARSYN-RXN]]
 +
* [[AICARTRANSFORM-RXN]]
 +
* [[FPAIF]]
 +
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[RXN-14270]]
 +
* [[RXN-17900]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-s-lactoylglutathione}}
+
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
+
{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}
{{#set: molecular-weight=378.376}}
+
{{#set: molecular-weight=336.197}}

Latest revision as of 11:15, 18 March 2021

Metabolite AICAR

  • common-name:
    • 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
  • inchi-key:
    • notgfiuvdgnkri-uuokfmhzsa-l
  • molecular-weight:
    • 336.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality