Difference between revisions of "CPD-9873"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...") |
(Created page with "Category:metabolite == Metabolite CPD-9873 == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...") |
||
(4 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-9873 == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** 3-demethylubiquinol-10 |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vlmqnhnmqvlpqi-avrcvibksa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 851.347 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9237]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=3-demethylubiquinol-10}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=851.347}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-9873
- common-name:
- 3-demethylubiquinol-10
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
- inchi-key:
- vlmqnhnmqvlpqi-avrcvibksa-n
- molecular-weight:
- 851.347