Difference between revisions of "CPD-9873"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...")
(Created page with "Category:metabolite == Metabolite CPD-9873 == * common-name: ** 3-demethylubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
 
(4 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14123 ==
+
== Metabolite CPD-9873 ==
 
* common-name:
 
* common-name:
** 3-amino-2,3-dideoxy-scyllo-inosose
+
** 3-demethylubiquinol-10
 
* smiles:
 
* smiles:
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
 
* inchi-key:
 
* inchi-key:
** fsugckmutgkwie-ygivhsipsa-o
+
** vlmqnhnmqvlpqi-avrcvibksa-n
 
* molecular-weight:
 
* molecular-weight:
** 162.165
+
** 851.347
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9237]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13118]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
+
{{#set: common-name=3-demethylubiquinol-10}}
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
+
{{#set: inchi-key=inchikey=vlmqnhnmqvlpqi-avrcvibksa-n}}
{{#set: molecular-weight=162.165}}
+
{{#set: molecular-weight=851.347}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-9873

  • common-name:
    • 3-demethylubiquinol-10
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
  • inchi-key:
    • vlmqnhnmqvlpqi-avrcvibksa-n
  • molecular-weight:
    • 851.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality