Difference between revisions of "Oligonucleotides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11712 == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))...")
(Created page with "Category:metabolite == Metabolite Oligonucleotides == * common-name: ** an oligonucleotide == Reaction(s) known to consume the compound == * 3.1.4.1-RXN == Reaction(s)...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11712 ==
+
== Metabolite Oligonucleotides ==
 
* common-name:
 
* common-name:
** 2-methyl-6-geranylgeranyl-1,4-benzoquinol
+
** an oligonucleotide
* smiles:
 
** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
 
* inchi-key:
 
** dowccbnjuzolrj-mlagypmbsa-n
 
* molecular-weight:
 
** 396.612
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14917]]
+
* [[3.1.4.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14929]]
+
* [[3.1.4.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: common-name=an oligonucleotide}}
{{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}}
 
{{#set: molecular-weight=396.612}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Oligonucleotides

  • common-name:
    • an oligonucleotide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality