Difference between revisions of "CPD-16551"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNAs-with-queuine == * common-name: ** a queuosine34 in trna == Reaction(s) known to consume the compound == == Reaction(s) known to pro...") |
(Created page with "Category:metabolite == Metabolite CPD-16551 == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakdp...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-16551 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-ribose 5-phosphate |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) | ||
| + | * inchi-key: | ||
| + | ** ktvpxoyakdprhy-txicztdvsa-l | ||
| + | * molecular-weight: | ||
| + | ** 228.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-ribose 5-phosphate}} |
| + | {{#set: inchi-key=inchikey=ktvpxoyakdprhy-txicztdvsa-l}} | ||
| + | {{#set: molecular-weight=228.095}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-16551
- common-name:
- β-d-ribose 5-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
- inchi-key:
- ktvpxoyakdprhy-txicztdvsa-l
- molecular-weight:
- 228.095
