Difference between revisions of "CPD-12126"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o * inchi-key: ** ierhlvcpsmictf-xvfcmesi...")
(Created page with "Category:metabolite == Metabolite CPD-12126 == * common-name: ** menaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CMP ==
+
== Metabolite CPD-12126 ==
 
* common-name:
 
* common-name:
** cmp
+
** menaquinol-9
 
* smiles:
 
* smiles:
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
* inchi-key:
** ierhlvcpsmictf-xvfcmesisa-l
+
** knwzipkbogoffc-uvzvdvbnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 321.183
+
** 787.263
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATCM]]
 
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-11832]]
 
* [[RXN-14026]]
 
* [[RXN-5781]]
 
* [[RXN-9614]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-9205]]
* [[2.7.8.11-RXN]]
 
* [[ATCY]]
 
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 
* [[DATCY]]
 
* [[DCTCP]]
 
* [[DGTCY]]
 
* [[DTTGY]]
 
* [[DUTCP]]
 
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 
* [[GTCY]]
 
* [[ITCY]]
 
* [[P-PANTOCYSLIG-RXN]]
 
* [[PHOSPHAGLYPSYN-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-12198]]
 
* [[RXN-12200]]
 
* [[RXN-17731]]
 
* [[RXN-17733]]
 
* [[RXN-5781]]
 
* [[RXN-8141]]
 
* [[RXN-9614]]
 
* [[RXN0-302]]
 
* [[RXN0-383]]
 
* [[RXN66-578]]
 
* [[UTCY]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cmp}}
+
{{#set: common-name=menaquinol-9}}
{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
+
{{#set: inchi-key=inchikey=knwzipkbogoffc-uvzvdvbnsa-n}}
{{#set: molecular-weight=321.183}}
+
{{#set: molecular-weight=787.263}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-12126

  • common-name:
    • menaquinol-9
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • knwzipkbogoffc-uvzvdvbnsa-n
  • molecular-weight:
    • 787.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality