Difference between revisions of "CPD-9089"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...")
(Created page with "Category:metabolite == Metabolite CPD-9089 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15424 ==
+
== Metabolite CPD-9089 ==
 +
* smiles:
 +
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** o-carbamoyladenylate
+
** phyta-2,10,14-trienyl bacteriochlorophyllide a
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
 
* inchi-key:
 
** chsnpofvfypelh-kqynxxcusa-m
 
 
* molecular-weight:
 
* molecular-weight:
** 389.241
+
** 906.478
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13167]]
+
* [[RXN-8789]]
* [[RXN-13168]]
+
* [[RXN-8790]]
* [[RXN-14553]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14552]]
+
* [[RXN-8789]]
 +
* [[RXN-8790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-carbamoyladenylate}}
+
{{#set: common-name=phyta-2,10,14-trienyl bacteriochlorophyllide a}}
{{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}}
+
{{#set: molecular-weight=906.478}}
{{#set: molecular-weight=389.241}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-9089

  • smiles:
    • ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • phyta-2,10,14-trienyl bacteriochlorophyllide a
  • molecular-weight:
    • 906.478

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality