Difference between revisions of "25S-rRNA-N1-methyladenine-2142"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXY-BUTANONE-P == * common-name: ** 1-deoxy-l-glycero-tetrulose 4-phosphate * smiles: ** cc(=o)c(o)cop(=o)([o-])[o-] * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite 25S-rRNA-N1-methyladenine-2142 == * common-name: ** n1-methyladenine2142 in 25s rrna == Reaction(s) known to consume the compound == == R...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROXY-BUTANONE-P ==
+
== Metabolite 25S-rRNA-N1-methyladenine-2142 ==
 
* common-name:
 
* common-name:
** 1-deoxy-l-glycero-tetrulose 4-phosphate
+
** n1-methyladenine2142 in 25s rrna
* smiles:
 
** cc(=o)c(o)cop(=o)([o-])[o-]
 
* inchi-key:
 
** okyhyxlctggolm-scsaibsysa-l
 
* molecular-weight:
 
** 182.069
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LUMAZINESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIOHBUTANONEPSYN-RXN]]
+
* [[RXN-14549]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-deoxy-l-glycero-tetrulose 4-phosphate}}
+
{{#set: common-name=n1-methyladenine2142 in 25s rrna}}
{{#set: inchi-key=inchikey=okyhyxlctggolm-scsaibsysa-l}}
 
{{#set: molecular-weight=182.069}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 25S-rRNA-N1-methyladenine-2142

  • common-name:
    • n1-methyladenine2142 in 25s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality